CAS 7245-02-5
:3-methoxyflavone
Description:
3-Methoxyflavone is a chemical compound belonging to the flavonoid class, characterized by its structure that includes a flavone backbone with a methoxy group (-OCH3) attached at the 3-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but has limited solubility in water. 3-Methoxyflavone is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Its molecular formula is C16H12O3, and it has a relatively stable structure under standard conditions. The presence of the methoxy group can influence its reactivity and interaction with biological systems, enhancing its lipophilicity and potentially affecting its bioavailability. As with many flavonoids, 3-methoxyflavone may also play a role in plant pigmentation and UV protection. However, further studies are often required to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C16H12O3
InChI:InChI=1/C16H12O3/c1-18-16-14(17)12-9-5-6-10-13(12)19-15(16)11-7-3-2-4-8-11/h2-10H,1H3
SMILES:COc1c(=O)c2ccccc2oc1c1ccccc1
Synonyms:- 3-Methoxy-2-phenyl-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-methoxy-2-phenyl-
- 3-methoxy-2-phenyl-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Methoxyflavone
CAS:Formula:C16H12O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:252.273-Methoxyflavone
CAS:3-Methoxyflavone is a Flavonoids, with antiviral activityFormula:C16H12O3Purity:99.29% - 99.97%Color and Shape:SolidMolecular weight:252.263-Methoxyflavone
CAS:3-Methoxyflavone is a synthetic flavonoid, which is a type of product known for its biological activities and potential therapeutic applications. It is derived from flavones, naturally occurring compounds found in various plants, known for their role in plant pigmentation and UV protection. The compound's mode of action is primarily through interaction with various biological targets, including modulation of enzyme activity and regulation of signal transduction pathways.Formula:C16H12O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:252.26 g/mol





