CAS 72458-85-6

(7aR,13aR)-6,7a-dihydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one

Description:

The chemical substance with the name "(7aR,13aR)-6,7a-dihydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one" and CAS number "72458-85-6" is a complex organic compound characterized by its unique chromeno-pyran structure. This compound features multiple hydroxyl (-OH) and methoxy (-OCH3) functional groups, which contribute to its potential biological activity and solubility properties. The presence of stereocenters indicated by the (7aR,13aR) configuration suggests that this molecule can exist in specific three-dimensional orientations, which may influence its interactions with biological targets. The dihydroxy and dimethoxy substitutions can enhance its reactivity and may play a role in its pharmacological effects. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Overall, the structural complexity and functional group diversity of this substance make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₂₃H₂₂O₈

InChI: InChI=1/C23H22O8/c1-22(2)6-5-11-14(31-22)8-13(24)19-20(11)30-18-10-29-15-9-17(28-4)16(27-3)7-12(15)23(18,26)21(19)25/h5-9,18,24,26H,10H2,1-4H3/t18-,23-/m1/s1

SMILES: CC1(C)C=Cc2c(cc(c3c2O[C@@H]2COc4cc(c(cc4[C@@]2(C3=O)O)OC)OC)O)O1

Synonyms:

• 3H-Bis(1)benzopyrano(3,4-b:6',5'-e)pyran-7(7aH)-one, 13,13a-dihydro-6,7a-dihydroxy-9,10-dimethoxy-3,3-dimethyl-, (7aR-cis)-

11-Hydroxytephrosin

CAS: 72458-85-6

Formula: C₂₃H₂₂O₈

Molecular weight: 426.4160

Ref: IN-DA00FENV

11-Hydroxytephrosin

CAS: 72458-85-6

11-Hydroxytephrosin inhibits NF-kappaB activity.

Formula: C₂₃H₂₂O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 426.42

Ref: TM-TN2588

11-Hydroxytephrosin

CAS: 72458-85-6

Formula: C₂₃H₂₂O₈

Purity: 95%~99%

Molecular weight: 426.421

Ref: BP-SBP02700

11-Hydroxytephrosin

CAS: 72458-85-6

11-Hydroxytephrosin is a bioactive compound classified as a rotenoid, which is derived from plant sources, particularly those in the Leguminosae family. This compound functions by interfering with cellular respiration, specifically targeting mitochondrial complex I, which ultimately leads to cellular energy production inhibition.

Formula: C₂₃H₂₂O₈

Purity: Min. 95%

Molecular weight: 426.4 g/mol

Ref: 3D-XCA45885