CAS 7250-55-7
:1,5-Dimethyl 3-hydroxypentanedioate
Description:
1,5-Dimethyl 3-hydroxypentanedioate, with the CAS number 7250-55-7, is an organic compound characterized by its diester functional groups and hydroxyl group. It features a five-carbon chain with two methyl groups located at the first and fifth positions, and a hydroxyl group at the third position, contributing to its reactivity and solubility properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of both ester and hydroxyl functionalities allows for potential applications in synthesis, such as in the production of polymers or as intermediates in organic synthesis. Additionally, its structural characteristics may influence its physical properties, such as boiling point and melting point, making it relevant in fields like pharmaceuticals and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H12O5
InChI:InChI=1S/C7H12O5/c1-11-6(9)3-5(8)4-7(10)12-2/h5,8H,3-4H2,1-2H3
InChI key:InChIKey=CUPGMRSSZADEIW-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)(CC(OC)=O)O
Synonyms:- 1,5-Dimethyl 3-hydroxypentanedioate
- 3-Hydroxyglutaric Acid Dimethyl Ester
- 3-Hydroxypentanedioic acid dimethyl ester
- Dimethyl 3-hydroxypentanedioate
- Dimethyl β-hydroxyglutarate
- Dimethyl-3-hydroxyglutarat
- Glutaric acid, 3-hydroxy-, dimethyl ester
- NSC 30047
- Nistc7250557
- Pentanedioic acid, 3-hydroxy-, 1,5-dimethyl ester
- Pentanedioic acid, 3-hydroxy-, dimethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl 3-Hydroxypentanedioate
CAS:Formula:C7H12O5Purity:96%Color and Shape:LiquidMolecular weight:176.1672Dimethyl 3-hydroxypentanedioate
CAS:Dimethyl 3-hydroxypentanedioateFormula:C7H12O5Purity:>98%Molecular weight:176.17Dimethyl 3-hydroxypentanedioate
CAS:Dimethyl 3-hydroxypentanedioateFormula:C7H12O5Purity:96%Molecular weight:176.17Dimethyl 3-hydroxypentanedioate
CAS:Formula:C7H12O5Purity:95%Color and Shape:LiquidMolecular weight:176.1683-Hydroxyglutaric Acid Dimethyl Ester
CAS:Controlled ProductApplications Glutaric Acid derivative
References Higashi, K., et al.: Chem. Pharm. Bull., 40, 1042 (1992), Wilde, J., et al.: Eur. J. Biochem., 221, 463 (1994),Formula:C7H12O5Color and Shape:NeatMolecular weight:176.17




