CAS 72580-54-2
:(3R)-3-Pyrrolidinecarboxylic acid
Description:
(3R)-3-Pyrrolidinecarboxylic acid, also known as L-proline, is a cyclic amino acid characterized by its five-membered ring structure containing a nitrogen atom. This compound is notable for its role in protein synthesis, where it contributes to the stability and structure of proteins due to its unique conformational properties. As a non-polar amino acid, it exhibits hydrophobic characteristics, which influence protein folding and interactions. The presence of a carboxylic acid functional group allows it to participate in various biochemical reactions, including enzyme catalysis and metabolic pathways. (3R)-3-Pyrrolidinecarboxylic acid is also recognized for its potential therapeutic applications, including roles in wound healing and as a precursor in the synthesis of other bioactive compounds. Its solubility in water and ability to form hydrogen bonds further enhance its biological relevance. Overall, this compound is essential in both biochemical processes and pharmaceutical development, making it a significant subject of study in organic and medicinal chemistry.
Formula:C5H9NO2
InChI:InChI=1/C5H9NO2/c7-5(8)4-1-2-6-3-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1
InChI key:InChIKey=JAEIBKXSIXOLOL-SCSAIBSYSA-N
SMILES:C(O)(=O)[C@@H]1CCNC1
Synonyms:- (3R)-3-Pyrrolidinecarboxylic acid
- (3R)-Pyrrolidine-3-carboxylic acid
- (3S)-3-Pyrrolidinecarboxylic acid
- (3S)-Pyrrolidinecarboxylic acid
- (3S)-pyrrolidine-3-carboxylic acid
- (R)-(-)-Pyrrolidine-3-carboxylic acid
- (R)-3-Pyrrolidinecarboxylic acid
- (R)-β-Proline
- (S)-Pyrrolidine-3-carboxylic acid
- 3-Pyrrolidinecarboxylic acid, (3R)-
- 3-Pyrrolidinecarboxylic acid, (R)-
- 4-(R)-3-Pyrrolidine carboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
D-β-Proline, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H9NO2Purity:98+%Molecular weight:115.13(3R)-pyrrolidine-3-carboxylic acid
CAS:Formula:C5H9NO2Purity:95%Color and Shape:SolidMolecular weight:115.1305[R]-Pyrrolidine-3-carboxylic acid
CAS:[R]-Pyrrolidine-3-carboxylic acidFormula:C5H9NO2Purity:98%Color and Shape:SolidMolecular weight:115.13045(R)-Pyrrolidine-3-carboxylic acid
CAS:(R)-Pyrrolidine-3-carboxylic acid is a proline derivative suitable for biochemical experiments and drug synthesis research.Formula:C5H9NO2Purity:99.95%Color and Shape:Yellow SolidMolecular weight:115.13(R)-(-)-Pyrrolidine-3-carboxylic acid
CAS:Formula:C5H9NO2Purity:95%Color and Shape:SolidMolecular weight:115.132






