CAS 72587-18-9
:2-Chloro-5-(trifluoromethyl)pyridin-3-amine
Description:
2-Chloro-5-(trifluoromethyl)pyridin-3-amine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 2-position and a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it a valuable moiety in drug design. Additionally, the amino group at the 3-position can participate in hydrogen bonding, further influencing its interactions with biological targets. The compound's CAS number, 72587-18-9, allows for its identification in chemical databases, facilitating research and development in various fields, including medicinal chemistry and material science. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C6H4ClF3N2
InChI:InChI=1/C6H4ClF3N2/c7-5-4(11)1-3(2-12-5)6(8,9)10/h1-2H,11H2
SMILES:c1c(cnc(c1N)Cl)C(F)(F)F
Synonyms:- 2-Chlor-5-(trifluormethyl)pyridin-3-amin
- 3-Pyridinamine, 2-Chloro-5-(Trifluoromethyl)-
- 2-Chloro-5-(Trifluoromethyl)-3-Pyridinamine
- 3-Amino-2-chloro-5-(trifluoromethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-2-chloro-5-(trifluoromethyl)pyridine, 98%
CAS:It's employed as a intermediate for pharmaceutical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not chaFormula:C6H4ClF3N2Purity:98%Molecular weight:196.562-CHLORO-5-(TRIFLUOROMETHYL)-3-PYRIDINAMINE
CAS:Formula:C6H4ClF3N2Purity:98%Color and Shape:SolidMolecular weight:196.55762-Chloro-5-(trifluoromethyl)pyridin-3-amine
CAS:2-Chloro-5-(trifluoromethyl)pyridin-3-amineFormula:C6H4ClF3N2Purity:98%Color and Shape:Off-white SolidMolecular weight:196.557562-Chloro-5-(trifluoromethyl)pyridin-3-amine
CAS:Formula:C6H4ClF3N2Purity:98%Color and Shape:Solid, Yellow powderMolecular weight:196.56



