CymitQuimica logo

CAS 72656-05-4

:

a-D-Glucopyranoside, methyl 3-O-b-D-glucopyranosyl-4,6-O-(phenylmethylene)-

Description:
The chemical substance known as a-D-Glucopyranoside, methyl 3-O-b-D-glucopyranosyl-4,6-O-(phenylmethylene)-, with the CAS number 72656-05-4, is a glycoside derivative characterized by its complex structure involving multiple sugar units and a phenylmethylene group. This compound features a glucopyranoside moiety, which is a six-membered cyclic form of glucose, indicating its role in carbohydrate chemistry. The presence of the methyl group and the phenylmethylene substituent suggests that it may exhibit unique solubility and reactivity properties, potentially influencing its biological activity and interactions. Glycosides like this one are often studied for their roles in natural products, pharmaceuticals, and as potential bioactive compounds. The specific stereochemistry and functional groups present in this molecule can affect its physical properties, such as melting point, solubility, and reactivity with other chemical species. Overall, this compound exemplifies the intricate nature of carbohydrate chemistry and its applications in various fields, including medicinal chemistry and biochemistry.
Formula:C20H28O11
InChI:InChI=1S/C20H28O11/c1-26-19-15(25)17(31-20-14(24)13(23)12(22)10(7-21)28-20)16-11(29-19)8-27-18(30-16)9-5-3-2-4-6-9/h2-6,10-25H,7-8H2,1H3/t10-,11-,12-,13+,14-,15-,16-,17-,18?,19+,20+/m1/s1
InChI key:URHVSGAXRNLQCN-SAULUABOSA-N
SMILES:CO[C@@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
Synonyms:
  • Pyrano[3,2-d]-1,3-dioxin,a-D-glucopyranoside deriv.
Found 2 products.