CymitQuimica logo

CAS 72678-94-5

:

2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid

Description:
2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a carboxylic acid functional group and a phenyl group substituted with three methoxy groups. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where thiazolidine derivatives are often explored for their therapeutic properties. The presence of the methoxy groups enhances the lipophilicity and may influence the compound's interaction with biological targets. Additionally, the thiazolidine moiety can participate in various chemical reactions, making it a versatile scaffold in organic synthesis. The compound's solubility, stability, and reactivity can be influenced by the substituents on the phenyl ring and the carboxylic acid group. Overall, 2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C13H17NO5S
InChI:InChI=1/C13H17NO5S/c1-17-9-4-7(5-10(18-2)11(9)19-3)12-14-8(6-20-12)13(15)16/h4-5,8,12,14H,6H2,1-3H3,(H,15,16)
SMILES:COc1cc(cc(c1OC)OC)C1NC(CS1)C(=O)O
Synonyms:
  • 4-Thiazolidinecarboxylic Acid, 2-(3,4,5-Trimethoxyphenyl)-
  • 2-(3,4,5-Trimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid
Found 1 products.