CymitQuimica logo

CAS 7274-08-0

:

(3β)-Cholest-5-en-3-yl (8Z,11Z,14Z)-8,11,14-eicosatrienoate

Description:
(3β)-Cholest-5-en-3-yl (8Z,11Z,14Z)-8,11,14-eicosatrienoate, commonly known as cholesteryl eicosatrienoate, is a lipid compound characterized by its ester formation between cholesterol and eicosatrienoic acid. This substance features a cholesterol backbone, which contributes to its amphipathic nature, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of multiple double bonds in the eicosatrienoate chain imparts unsaturation, influencing its fluidity and biological functions. Cholesteryl eicosatrienoate is primarily found in biological membranes and is involved in various physiological processes, including cell signaling and membrane structure. Its unique structure allows it to play a role in lipid metabolism and may be implicated in the development of certain diseases, including cardiovascular conditions. Additionally, this compound can be analyzed using techniques such as chromatography and mass spectrometry for research and clinical applications. Overall, cholesteryl eicosatrienoate exemplifies the complex interplay between lipids and biological functions in living organisms.
Formula:C47H78O2
InChI:InChI=1S/C47H78O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-45(48)49-40-32-34-46(5)39(36-40)28-29-41-43-31-30-42(38(4)26-24-25-37(2)3)47(43,6)35-33-44(41)46/h11-12,14-15,17-18,28,37-38,40-44H,7-10,13,16,19-27,29-36H2,1-6H3/b12-11-,15-14-,18-17-/t38-,40+,41+,42-,43+,44+,46+,47-/m1/s1
InChI key:InChIKey=MLPRJPSMAFZPLA-BBFGHUFCSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])(CC=C1C[C@@H](OC(CCCCCC/C=C\C/C=C\C/C=C\CCCCC)=O)CC2)[H])[H]
Synonyms:
  • Cholesterol, 8,11,14-eicosatrienoate
  • Cholest-5-en-3-ol (3β)-, 3-(8Z,11Z,14Z)-8,11,14-eicosatrienoate
  • Cholest-5-en-3-ol (3β)-, (8Z,11Z,14Z)-8,11,14-eicosatrienoate
  • (3β)-Cholest-5-en-3-yl (8Z,11Z,14Z)-8,11,14-eicosatrienoate
Found 2 products.