CymitQuimica logo

CAS 72768-97-9

:

(2,2-difluoro-1,3-benzodioxol-5-yl)methanol

Description:
(2,2-Difluoro-1,3-benzodioxol-5-yl)methanol is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety substituted with two fluorine atoms and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of fluorine atoms often enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group can participate in hydrogen bonding, affecting its interactions in biological systems. Additionally, the compound may display stability under standard conditions, although specific reactivity can depend on the surrounding environment and conditions. Its CAS number, 72768-97-9, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, (2,2-difluoro-1,3-benzodioxol-5-yl)methanol represents a versatile structure with potential implications in chemical synthesis and biological activity.
Formula:C8H6F2O3
InChI:InChI=1/C8H6F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-3,11H,4H2
InChI key:PJPDSEYHEHGLOH-UHFFFAOYSA-N
SMILES:c1cc2c(cc1CO)OC(F)(F)O2
Found 4 products.