CAS 72784-42-0
:1-aminocyclopropane-1-carboxylic acid*methyl este
Description:
1-Aminocyclopropane-1-carboxylic acid methyl ester, identified by CAS number 72784-42-0, is an organic compound characterized by its cyclopropane structure, which includes an amino group and a carboxylic acid moiety esterified with a methyl group. This compound is notable for its role as a plant growth regulator, particularly in the context of ethylene biosynthesis, as it serves as a precursor to ethylene, a vital hormone in plants that regulates various physiological processes. The presence of the amino group contributes to its reactivity and potential interactions in biological systems. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. Its solubility in polar solvents like water and alcohols makes it accessible for various applications in agricultural and biochemical research. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H10ClNO2
InChI:InChI=1/C5H9NO2.ClH/c1-8-4(7)5(6)2-3-5;/h2-3,6H2,1H3;1H
SMILES:COC(=O)C1(CC1)N.Cl
Synonyms:- 1-Aminocyclopropane-1-carboxylic acid methyl ester, Hydrochloride
- 1-(Methoxycarbonyl)Cyclopropanaminium Chloride
- 1,1-Accp(Ome)
- Methyl 1-Aminocyclopropane-1-Carboxylate Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 1-aminocyclopropanecarboxylate, HCl
CAS:Formula:C5H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:151.5914Ref: IN-DA0036Q5
1kgTo inquire250mgTo inquire500gTo inquire1g20.00€5g28.00€10g46.00€25g72.00€100g157.00€Methyl 1-Aminocyclopropanecarboxylate Hydrochloride
CAS:Formula:C5H9NO2·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:151.59Methyl 1-aminocyclopropanecarboxylate HCl
CAS:Methyl 1-aminocyclopropanecarboxylate hydrochlorideFormula:C5H10ClNO2Purity:97%Molecular weight:151.59Methyl 1-aminocyclopropane-1-carboxylate hydrochloride
CAS:Methyl 1-aminocyclopropane-1-carboxylate hydrochlorideFormula:C5H9NO2·ClHPurity:>98%Color and Shape:SolidMolecular weight:151.5914Methyl 1-aminocyclopropanecarboxylate hydrochloride
CAS:Formula:C5H10ClNO2Purity:95%Color and Shape:SolidMolecular weight:151.59





