CymitQuimica logo

CAS 72784-42-0

:

1-aminocyclopropane-1-carboxylic acid*methyl este

Description:
1-Aminocyclopropane-1-carboxylic acid methyl ester, identified by CAS number 72784-42-0, is an organic compound characterized by its cyclopropane structure, which includes an amino group and a carboxylic acid moiety esterified with a methyl group. This compound is notable for its role as a plant growth regulator, particularly in the context of ethylene biosynthesis, as it serves as a precursor to ethylene, a vital hormone in plants that regulates various physiological processes. The presence of the amino group contributes to its reactivity and potential interactions in biological systems. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. Its solubility in polar solvents like water and alcohols makes it accessible for various applications in agricultural and biochemical research. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H10ClNO2
InChI:InChI=1/C5H9NO2.ClH/c1-8-4(7)5(6)2-3-5;/h2-3,6H2,1H3;1H
InChI key:CHSDCWKLSHPKFY-UHFFFAOYSA-N
SMILES:COC(=O)C1(CC1)N.Cl
Synonyms:
  • 1-Aminocyclopropane-1-carboxylic acid methyl ester, Hydrochloride
  • 1-(Methoxycarbonyl)Cyclopropanaminium Chloride
  • 1,1-Accp(Ome)
  • Methyl 1-Aminocyclopropane-1-Carboxylate Hydrochloride
Found 6 products.