CAS 73096-42-1
:5-(2-Bromophenyl)-2H-tetrazole
Description:
5-(2-Bromophenyl)-2H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 2-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the second position, contributing to the compound's unique reactivity and properties. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may show varying degrees of stability depending on environmental conditions. It is often utilized in synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. The presence of the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, 5-(2-Bromophenyl)-2H-tetrazole may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.
Formula:C7H5BrN4
InChI:InChI=1S/C7H5BrN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12)
InChI key:InChIKey=YHVBXKTXLJTDRI-UHFFFAOYSA-N
SMILES:BrC1=C(C=2NN=NN2)C=CC=C1
Synonyms:- 1H-Tetrazole, 5-(2-bromophenyl)-
- 2H-Tetrazole, 5-(2-bromophenyl)-
- 5-(2-Bromophenyl)Tetrazol-1-Ide
- 5-(2-Bromophenyl)tetrazole
- 5-(2-bromophenyl)-2H-tetrazole
- 5-(o-Bromophenyl)tetrazole
- Tetrazole, 5-(o-bromophenyl)-
- 5-(2-Bromophenyl)-1H-tetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(2-Bromophenyl)-1H-tetrazole
CAS:Formula:C7H5BrN4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:225.055-(2-bromophenyl)-1H-tetrazole
CAS:Formula:C7H5BrN4Purity:98%Color and Shape:SolidMolecular weight:225.04545-(2-Bromophenyl)-1H-tetrazole
CAS:5-(2-Bromophenyl)-1H-tetrazole is a synthetic bidentate ligand that has an inhibitory effect on the enzyme nitric oxide synthase. It has been shown to inhibit the production of nitric oxide in cells by binding to iron and copper ions, which are essential for the synthesis of nitric oxide. 5-(2-Bromophenyl)-1H-tetrazole has a luminescent property, with a wavelength at around 530 nm. This compound is also characterized by its photophysical properties, such as high quantum yield, fast decay time, and low solubility in organic solvents. The inhibition mechanism of 5-(2-bromophenyl)-1H-tetrazole is not yet fully understood but it is thought to be related to its ability to bind chloride ions, which are required for nitric oxide synthesis.
Formula:C7H5BrN4Purity:Min. 95%Color and Shape:SolidMolecular weight:225.05 g/mol




