CymitQuimica logo

CAS 730996-05-1

:

3-azepan-1-ylpropanoic acid

Description:
3-Azepan-1-ylpropanoic acid, identified by its CAS number 730996-05-1, is an organic compound characterized by the presence of a seven-membered nitrogen-containing ring (azepane) and a propanoic acid functional group. This compound features a primary amine group, which contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The azepane ring provides a degree of flexibility and can influence the compound's conformational properties, potentially affecting its biological activity. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of both the azepane and carboxylic acid functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or biologically active compounds. Additionally, the compound's structural characteristics may allow for interactions with biological targets, making it of interest in drug design and development. Overall, 3-azepan-1-ylpropanoic acid is a versatile compound with unique properties that warrant further investigation.
Formula:C9H17NO2
InChI:InChI=1/C9H17NO2/c11-9(12)5-8-10-6-3-1-2-4-7-10/h1-8H2,(H,11,12)
InChI key:XQLMHRJUEUXBPF-UHFFFAOYSA-N
SMILES:C1CCCN(CC1)CCC(=O)O
Synonyms:
  • 1H-azepine-1-propanoic acid, hexahydro-
  • 3-(Azepan-1-Yl)Propanoic Acid
Found 4 products.