CymitQuimica logo

CAS 7310-97-6

:

2,5-Dimethoxy-1,4-benzenedicarboxaldehyde

Description:
2,5-Dimethoxy-1,4-benzenedicarboxaldehyde, with the CAS number 7310-97-6, is an organic compound characterized by its aromatic structure featuring two methoxy groups and two aldehyde functional groups. This compound is a derivative of phthalic aldehyde, where the methoxy groups are positioned at the 2 and 5 positions of the benzene ring. It typically appears as a crystalline solid and is soluble in organic solvents such as ethanol and dichloromethane, but less soluble in water due to its hydrophobic aromatic nature. The presence of aldehyde groups makes it reactive, particularly in condensation reactions and as a potential precursor in organic synthesis. Its methoxy substituents can influence its reactivity and stability, often enhancing its electron-donating properties. This compound may be of interest in various fields, including organic synthesis, materials science, and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and other functional materials. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-6H,1-2H3
InChI key:YSIIHTHHMPYKFP-UHFFFAOYSA-N
SMILES:COc1cc(C=O)c(cc1C=O)OC
Found 6 products.