CymitQuimica logo

CAS 73204-07-6

:

4-(4-Oxocyclohexyl)benzonitrile

Description:
4-(4-Oxocyclohexyl)benzonitrile, with the CAS number 73204-07-6, is an organic compound characterized by its structural features, which include a benzonitrile moiety and a cyclohexyl group containing a ketone functional group. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and materials science. The presence of the nitrile group (-C≡N) contributes to its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the ketone functionality can participate in further chemical transformations, such as nucleophilic additions. The compound's properties, including solubility and melting point, can vary based on the specific conditions and purity. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose health risks if not managed properly. Overall, 4-(4-Oxocyclohexyl)benzonitrile is of interest in research and industrial applications due to its unique structural characteristics.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-4,12H,5-8H2
InChI key:InChIKey=XFRVACCGEKPJDI-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(C=C1)C2CCC(=O)CC2
Synonyms:
  • 4-(p-Cyanophenyl)cyclohexanone
  • Benzonitrile, 4-(4-Oxocyclohexyl)-
  • 4-(4-Oxocyclohexyl)benzonitrile
Found 4 products.