CymitQuimica logo

CAS 7325-16-8

:

glycer(ol-D3)

Description:
Glycerol-D3, also known as glycerol-1,2,3-D3, is a deuterated form of glycerol, a simple polyol compound. Its molecular formula is C3H8O3, but in this isotopically labeled version, three hydrogen atoms are replaced with deuterium, resulting in a molecular formula of C3D8O3. Glycerol-D3 is a colorless, odorless, and hygroscopic liquid that is soluble in water and alcohol. It is commonly used in various scientific applications, particularly in metabolic studies and tracer experiments, due to its ability to provide insights into biochemical pathways without interfering with the natural processes being studied. The presence of deuterium allows for the use of nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry for tracking and analyzing metabolic processes. Glycerol itself is known for its role as a humectant, solvent, and sweetener in food and pharmaceutical formulations, and the deuterated variant retains these properties while offering additional analytical advantages.
Formula:C3H5D3O3
InChI:InChI=1/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i4D,5D,6D
SMILES:C(C(CO[2H])O[2H])O[2H]
Synonyms:
  • propane-1,2,3-(2H3)triol
Found 2 products.