CAS 73341-58-9

Formula: C20H30O4

InChI: InChI=1S/C20H30O4/c1-15(8-6-9-16(2)14-17(21)22)10-13-20(24)18(3,4)11-7-12-19(20,5)23/h6,8-10,13-14,23-24H,7,11-12H2,1-5H3,(H,21,22)/b9-6+,13-10+,15-8+,16-14+

InChI key: YUVFZJLCCGCMNF-WEDZBJJJSA-N

SMILES: C/C(=C\C=C\C(=C\C(=O)O)\C)/C=C/C1(C(CCCC1(C)O)(C)C)O

5,6-Dihydro-5,6-Dihydroxy Retinoic Acid

CAS: 102491-35-0, 73341-58-9

Formula: C₂₀H₃₀O₄

Color and Shape: Yellow Solid

Molecular weight: 334.46

Ref: 4Z-R-3815

Ro 22-5112

Controlled Product

CAS: 73341-58-9

Formula: C₂₀H₃₀O₄

Color and Shape: Neat

Molecular weight: 334.45

Ref: TR-R637180

Ro 22-5112-d5

Controlled Product

CAS: 102491-35-0, 73341-58-9

Formula: C₂₀H₂₅D₅O₄

Color and Shape: Neat

Molecular weight: 339.48

Ref: TR-R637182

Ro 22-5112

CAS: 73341-58-9

Ro 22-5112 is an investigational pharmaceutical compound primarily characterized as an adrenergic receptor modulator. It is synthetically derived and designed to interact with specific adrenergic receptors within the human body. The mode of action of Ro 22-5112 involves binding to these receptors, leading to the modulation of adrenergic signaling pathways. This interaction can influence various physiological responses such as heart rate, vascular resistance, and neurotransmitter release.

Formula: C₂₀H₃₀O₄

Purity: Min. 95%

Molecular weight: 334.45 g/mol

Ref: 3D-YCA34158

5,6-Dihydro-5,6-Dihydroxy Retinoic Acid

CAS: 73341-58-9

Formula: C₂₀H₃₀O₄

Molecular weight: 334.46

Ref: ST-EA-CP-R93025