CymitQuimica logo

CAS 73367-80-3

:

12-bromododecanoic acid

Description:
12-Bromododecanoic acid is a halogenated fatty acid characterized by the presence of a bromine atom at the 12th carbon of the dodecanoic acid chain, which consists of 12 carbon atoms. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its long hydrophobic carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, including the preparation of surfactants and intermediates in organic chemistry. Its molecular structure contributes to its potential biological activity, which may include antimicrobial properties. Additionally, 12-bromododecanoic acid can be utilized in studies related to lipid metabolism and membrane dynamics. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact. Proper handling and disposal methods are essential to mitigate risks associated with its use in laboratory and industrial settings.
Formula:C12H23BrO2
InChI:InChI=1/C12H23BrO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11H2,(H,14,15)
InChI key:InChIKey=YYKBWYBUCFHYPR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCBr)CCC(O)=O
Synonyms:
  • 12-Bromolauric acid
  • Dodecanoic acid, 12-bromo-
  • NSC 660375
  • ω-Bromododecanoic acid
  • 12-Bromododecanoic acid
Found 6 products.