CymitQuimica logo

CAS 733740-48-2

:

rel-(1R,3S)-3-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid

Description:
Rel-(1R,3S)-3-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid, identified by its CAS number 733740-48-2, is a chemical compound characterized by its cyclopentane structure, which includes a carboxylic acid functional group and a nitrophenyl substituent. The specific stereochemistry indicated by the (1R,3S) configuration suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. The presence of the nitrophenyl group typically enhances the compound's electrophilic properties, making it potentially useful in various chemical reactions or as a pharmacophore in medicinal chemistry. Additionally, the carboxylic acid group contributes to its acidity and solubility in polar solvents. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in research related to pharmaceuticals or agrochemicals. Its unique structure and functional groups can lead to diverse applications in synthetic chemistry and drug development.
Formula:C14H15NO5
InChI:InChI=1/C14H15NO5/c16-13(8-9-5-6-10(7-9)14(17)18)11-3-1-2-4-12(11)15(19)20/h1-4,9-10H,5-8H2,(H,17,18)/t9-,10+/s2
InChI key:InChIKey=CBXLWDHZPOMUJU-NLJMKPLXNA-N
SMILES:C(C[C@H]1C[C@@H](C(O)=O)CC1)(=O)C2=C(N(=O)=O)C=CC=C2
Synonyms:
  • rel-(1R,3S)-3-[2-(2-Nitrophenyl)-2-oxoethyl]cyclopentanecarboxylic acid
  • Cyclopentanecarboxylic acid, 3-[2-(2-nitrophenyl)-2-oxoethyl]-, (1R,3S)-rel-
Found 1 products.