CAS 7342-82-7
:3-bromothianaphthene
Description:
3-Bromothianaphthene is an organic compound characterized by its structure, which consists of a thianaphthene core with a bromine substituent at the 3-position. This compound belongs to the class of polycyclic aromatic compounds, which are known for their stability and unique electronic properties. The presence of the bromine atom introduces both electrophilic and nucleophilic characteristics, making it a versatile intermediate in organic synthesis. 3-Bromothianaphthene is typically a solid at room temperature and may exhibit a range of physical properties such as melting and boiling points that are influenced by its molecular structure. It is often used in research and development, particularly in the fields of materials science and organic electronics, due to its potential applications in the synthesis of novel organic semiconductors. Additionally, like many brominated compounds, it may have implications for environmental and health safety, necessitating careful handling and disposal. Overall, 3-bromothianaphthene is a significant compound in organic chemistry with various applications in scientific research.
Formula:C8H5BrS
InChI:InChI=1/C8H5BrS/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5H
SMILES:c1ccc2c(c1)c(cs2)Br
Synonyms:- 3-Bromo-1-benzothiophene
- 3-Bromobenzo[b]thiophene
- 3-Bromobenzothiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromobenzo[b]thiophene
CAS:Formula:C8H5BrSPurity:>96.0%(GC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:213.093-Bromobenzo[b]thiophene, 95%
CAS:Antifungal activity of synthetic di (hetero) arylamines based on the benzo [b] thiophene moiety. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar proFormula:C8H5BrSPurity:95%Color and Shape:Clear colorless to yellow to red, LiquidMolecular weight:213.093-Bromobenzo[b]thiophene
CAS:Formula:C8H5BrSPurity:95%Color and Shape:LiquidMolecular weight:213.09433-Bromobenzo[b]thiophene
CAS:3-Bromobenzo[b]thiopheneFormula:C8H5BrSPurity:97%Color and Shape:LiquidMolecular weight:213.0943




