CAS 7345-82-6
:trans-2,3-dimethoxycinnamic acid
Description:
Trans-2,3-dimethoxycinnamic acid is an organic compound characterized by its structure, which features a cinnamic acid backbone with two methoxy groups attached to the second and third carbon atoms of the double bond. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and cosmetics, due to its antioxidant and anti-inflammatory properties. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. Trans-2,3-dimethoxycinnamic acid can undergo various chemical reactions, such as esterification and hydrogenation, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be affected by factors such as pH and temperature. Additionally, it may exhibit UV absorbance, which can be relevant in formulations aimed at protecting skin from UV radiation. Overall, trans-2,3-dimethoxycinnamic acid is a compound of interest in both research and industrial applications.
Formula:C11H11O4
InChI:InChI=1/C11H12O4/c1-14-9-5-3-4-8(11(9)15-2)6-7-10(12)13/h3-7H,1-2H3,(H,12,13)/p-1/b7-6+
Synonyms:- 2,3-Dimethoxycinnamic acid
- 2',3'-Dimethoxycinnamic acid
- 3-(2,3-Dimethoxyphenyl)Prop-2-Enoic Acid
- (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid
- (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dimethoxycinnamic acid, predominantly trans, 98+%
CAS:<p>2,3-Dimethoxycinnamic acid is used in the synthesis of (2E,2E,2E)-N,N,N-(nitrilotri-2,1-ethanediyl)tris[3-(2,3-dimethoxyphenyl)-2-propenamide]. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer t</p>Formula:C11H12O4Purity:98+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:208.21trans-2,3-Dimethoxycinnamic Acid
CAS:Formula:C11H12O4Purity:98%Color and Shape:SolidMolecular weight:208.21063-(2,3-dimethoxyphenyl)acrylic acid
CAS:3-(2,3-dimethoxyphenyl)acrylic acidPurity:98%Molecular weight:208.21g/moltrans-2,3-Dimethoxycinnamic Acid
CAS:Formula:C11H12O4Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:208.21trans-2,3-Dimethoxycinnamic Acid
CAS:<p>Trans-2,3-dimethoxycinnamic acid is a dicarboxylic acid that is formed through the condensation of phenylacetic acid and methanol. This compound has been used in the synthesis of pharmaceuticals, such as antihistamines. Trans-2,3-dimethoxycinnamic acid has also been shown to have antioxidant properties by scavenging free radicals produced during lipid peroxidation.</p>Formula:C11H12O4Purity:Min. 95%Molecular weight:208.21 g/mol




