CymitQuimica logo

CAS 7345-82-6

:

trans-2,3-dimethoxycinnamic acid

Description:
Trans-2,3-dimethoxycinnamic acid is an organic compound characterized by its structure, which features a cinnamic acid backbone with two methoxy groups attached to the second and third carbon atoms of the double bond. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and cosmetics, due to its antioxidant and anti-inflammatory properties. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. Trans-2,3-dimethoxycinnamic acid can undergo various chemical reactions, such as esterification and hydrogenation, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be affected by factors such as pH and temperature. Additionally, it may exhibit UV absorbance, which can be relevant in formulations aimed at protecting skin from UV radiation. Overall, trans-2,3-dimethoxycinnamic acid is a compound of interest in both research and industrial applications.
Formula:C11H11O4
InChI:InChI=1/C11H12O4/c1-14-9-5-3-4-8(11(9)15-2)6-7-10(12)13/h3-7H,1-2H3,(H,12,13)/p-1/b7-6+
InChI key:QAXPUWGAGVERSJ-VOTSOKGWSA-N
SMILES:COC1=CC=CC(=C1OC)/C=C/C(=O)O
Synonyms:
  • 2,3-Dimethoxycinnamic acid
  • 2',3'-Dimethoxycinnamic acid
  • 3-(2,3-Dimethoxyphenyl)Prop-2-Enoic Acid
  • (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid
  • (2E)-3-(2,3-dimethoxyphenyl)prop-2-enoate
Found 6 products.