CymitQuimica logo

CAS 734531-00-1

:

Imidazo[1,5-a]pyrazine,5,6,7,8-tetrahydro-3-methyl-

Description:
Imidazo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-3-methyl- is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and a methyl group at the 3-position, which can influence its reactivity and biological activity. The presence of nitrogen atoms in the ring structure enhances its potential for forming hydrogen bonds and participating in various chemical reactions. Typically, such compounds exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure allows for diverse interactions with biological targets, which can lead to applications in treating various diseases. Additionally, the compound's solubility, stability, and reactivity can vary based on its specific functional groups and the overall molecular architecture. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its potential applications in research and industry.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-6-9-5-7-4-8-2-3-10(6)7/h5,8H,2-4H2,1H3
InChI key:GMMYNKQIGMWPCQ-UHFFFAOYSA-N
SMILES:CC1=NC=C2N1CCNC2
Synonyms:
  • midazo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-3-methyl- (9CI)
  • 3-Methyl-5,6,7,8-Tetrahydroimidazo[1,5-A]Pyrazine
Found 4 products.