CAS 7351-74-8

1,5-dibromonaphthalene

Description:

1,5-Dibromonaphthalene is an organic compound characterized by the presence of two bromine atoms attached to the naphthalene structure at the 1 and 5 positions. It is a member of the polycyclic aromatic hydrocarbons (PAHs) and exhibits a fused ring system, which contributes to its stability and unique chemical properties. This compound is typically a solid at room temperature, with a crystalline appearance, and is known for its relatively high melting and boiling points compared to many other organic compounds. 1,5-Dibromonaphthalene is sparingly soluble in water but soluble in organic solvents such as ethanol, acetone, and chloroform. It is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, due to the presence of bromine, it can participate in electrophilic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.

Formula: C₁₀H₆Br₂

InChI: InChI=1S/C10H6Br2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6H

SMILES: c1cc2c(cccc2Br)c(c1)Br

1,5-Dibromonaphthalene

CAS: 7351-74-8

Formula: C₁₀H₆Br₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 285.97

Ref: 3B-D4660

1,5-Dibromonaphthalene

CAS: 7351-74-8

Formula: C₁₀H₆Br₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 285.9626

Ref: IN-DA003DQ3

1,5-Dibromonaphthalene

CAS: 7351-74-8

1,5-Dibromonaphthalene

Formula: C₁₀H₆Br₂

Purity: 96%

Color and Shape: pale lemon crystalline solid

Molecular weight: 285.96g/mol

Ref: 54-OR16492

1,5-Dibromonaphthalene

CAS: 7351-74-8

Formula: C₁₀H₆Br₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 285.966

Ref: 10-F227780