CymitQuimica logo

CAS 7351-74-8

:

1,5-dibromonaphthalene

Description:
1,5-Dibromonaphthalene is an organic compound characterized by the presence of two bromine atoms attached to the naphthalene structure at the 1 and 5 positions. It is a member of the polycyclic aromatic hydrocarbons (PAHs) and exhibits a fused ring system, which contributes to its stability and unique chemical properties. This compound is typically a solid at room temperature, with a crystalline appearance, and is known for its relatively high melting and boiling points compared to many other organic compounds. 1,5-Dibromonaphthalene is sparingly soluble in water but soluble in organic solvents such as ethanol, acetone, and chloroform. It is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, due to the presence of bromine, it can participate in electrophilic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C10H6Br2
InChI:InChI=1S/C10H6Br2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6H
InChI key:CZYAFTZIQWCKOI-UHFFFAOYSA-N
SMILES:c1cc2c(cccc2Br)c(c1)Br
Found 5 products.