CAS 7355-55-7
:7-Deazaguanine
Description:
7-Deazaguanine, with the CAS number 7355-55-7, is a purine derivative that is structurally related to guanine, differing by the absence of a nitrogen atom at the 7-position of the purine ring. This modification imparts unique properties to the molecule, making it of interest in various biochemical and pharmaceutical applications. It is a white to off-white crystalline solid that is soluble in water and polar organic solvents. 7-Deazaguanine is known for its role as a nucleoside analog, which can interfere with nucleic acid synthesis and function, making it a potential candidate for antiviral and anticancer therapies. Additionally, it can be utilized in research to study the mechanisms of nucleic acid metabolism and the effects of modified nucleobases on biological systems. Its stability and reactivity are influenced by the surrounding pH and the presence of other chemical species, which can affect its biological activity. Overall, 7-deazaguanine serves as a valuable tool in both medicinal chemistry and molecular biology.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H4,7,8,9,10,11)
SMILES:c1c[nH]c2c1c(nc(=N)[nH]2)O
Synonyms:- 4H-Pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-1,7-dihydro-
- 2-amino-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
- 2-Amino-4-hydroxypyrrolo[2,3-d]pyrimidine
- 2-Amino-3H-pyrrolo[2,3-d]pyrimidin-4(7H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2-Amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one
CAS:Formula:C6H6N4OPurity:97%Color and Shape:SolidMolecular weight:150.13802-Amino-7H-pyrrolo[2,3-d]pyrimidin-4-ol
CAS:2-Amino-7H-pyrrolo[2,3-d]pyrimidin-4-olFormula:C6H6N4OPurity:97%Molecular weight:150.138042-Amino-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
CAS:2-Amino-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-oneFormula:C6H6N4OPurity:≥95%Color and Shape:Solid-PowderMolecular weight:150.138042-Amino-4-hydroxypyrrolo[2,3- d]pyrimidi
CAS:2-Amino-4-hydroxypyrrolo[2,3- d]pyrimidiFormula:C6H6N4OPurity:≥95%Molecular weight:150.142-Amino-7H-pyrrolo[2,3-d]pyrimidin-4-ol
CAS:Formula:C6H6N4OPurity:85.0%Color and Shape:SolidMolecular weight:150.0542-Amino-4-hydroxypyrrolo[2,3- d]pyrimidi
CAS:2-Amino-4-hydroxypyrrolo[2,3-d]pyrimidine serves as an intermediate.Formula:C6H6N4OPurity:99.21% - 99.39%Color and Shape:SolidMolecular weight:150.147-Deazaguanine
CAS:7-Deazaguanine is a nucleoside with potential as an antiviral agent. 7-Deazaguanine inhibits the activity of the enzyme RNA polymerase II, which is required for viral replication. The drug binds to the DNA template, inhibiting polymerase chain reaction (PCR), and prevents transcription of viral RNA by hydrogen bonding to its complementary strands. In addition, it has been shown to reduce the production of epidermal growth factor in cells.Formula:C6H6N4OPurity:Min. 95%Color and Shape:Brown PowderMolecular weight:150.14 g/mol7-Deazaguanine
CAS:Controlled ProductApplications 7-Deazaguanine (cas# 7355-55-7) is a compound useful in organic synthesis.
Formula:C6H6N4OColor and Shape:NeatMolecular weight:150.14







