CymitQuimica logo

CAS 73568-29-3

:

2-Chloro-6-methoxyquinoline-3-carboxaldehyde

Description:
2-Chloro-6-methoxyquinoline-3-carboxaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chloro group at the 2-position and a methoxy group at the 6-position contributes to its unique reactivity and properties. The carboxaldehyde functional group at the 3-position makes it an aldehyde, which is known for its reactivity in various chemical reactions, including nucleophilic addition and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 2-Chloro-6-methoxyquinoline-3-carboxaldehyde is a versatile compound with significant implications in chemical research and development.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c1-15-9-2-3-10-7(5-9)4-8(6-14)11(12)13-10/h2-6H,1H3
InChI key:InChIKey=TZQOMBXDCIPJKW-UHFFFAOYSA-N
SMILES:C(=O)C1=CC2=C(N=C1Cl)C=CC(OC)=C2
Synonyms:
  • 2-Chloro-3-formyl-6-methoxyquinoline
  • 2-Chloro-6-Methoxyquinoline-3-Carbaldehyde
  • 2-Chloro-6-methoxy-3-quinolinecarboxaldehyde
  • 2-Chloro-6-methoxyquinoline-3-carboxaldehyde
  • 3-Quinolinecarboxaldehyde, 2-chloro-6-methoxy-
Found 4 products.