CymitQuimica logo

CAS 73572-58-4

:

Boc-Phe-Leu-Phe-Leu-Phe-OH

Description:
Boc-Phe-Leu-Phe-Leu-Phe-OH, with the CAS number 73572-58-4, is a synthetic peptide that features a sequence of amino acids, specifically phenylalanine (Phe) and leucine (Leu), with a tert-butyloxycarbonyl (Boc) protecting group on the N-terminus. This compound is characterized by its hydrophobic nature due to the presence of aromatic and aliphatic side chains, which can influence its solubility and interaction with biological membranes. The Boc group serves as a protective moiety that facilitates peptide synthesis by preventing unwanted reactions at the amino group. Peptides like Boc-Phe-Leu-Phe-Leu-Phe-OH are often studied for their potential biological activities, including their roles in signaling pathways and as potential therapeutic agents. Additionally, the structural arrangement of the amino acids can affect the peptide's conformation, stability, and binding affinity to various targets. Overall, this compound exemplifies the complexity and versatility of peptide chemistry in both research and pharmaceutical applications.
Formula:C44H5N5O8
InChI:InChI=1S/C44H59N5O8/c1-28(2)23-33(46-41(53)36(26-31-19-13-9-14-20-31)49-43(56)57-44(5,6)7)38(50)47-35(25-30-17-11-8-12-18-30)40(52)45-34(24-29(3)4)39(51)48-37(42(54)55)27-32-21-15-10-16-22-32/h8-22,28-29,33-37H,23-27H2,1-7H3,(H,45,52)(H,46,53)(H,47,50)(H,48,51)(H,49,56)(H,54,55)/t33-,34-,35-,36-,37-/m0/s1
InChI key:NGNZQSPFQJCBJQ-LTLCPEALSA-N
SMILES:CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)OC(C)(C)C
Found 3 products.