CymitQuimica logo

CAS 73605-91-1

:

Ethyl benzotriazole-5-carboxylate

Description:
Ethyl benzotriazole-5-carboxylate, with the CAS number 73605-91-1, is an organic compound that belongs to the class of benzotriazoles, which are known for their applications in various fields, including pharmaceuticals and materials science. This compound features a benzotriazole ring, which is a five-membered heterocyclic structure containing nitrogen atoms, and a carboxylate functional group that contributes to its reactivity and solubility properties. Ethyl benzotriazole-5-carboxylate is typically characterized by its moderate polarity, which allows it to dissolve in various organic solvents while exhibiting limited solubility in water. The presence of the ethyl group enhances its lipophilicity, making it suitable for incorporation into different formulations. Additionally, this compound may exhibit UV-absorbing properties, which can be beneficial in applications such as UV stabilizers in plastics and coatings. Its chemical stability and ability to form complexes with metals also make it of interest in catalysis and coordination chemistry. Overall, ethyl benzotriazole-5-carboxylate is a versatile compound with potential utility across multiple domains.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-2-14-9(13)6-3-4-7-8(5-6)11-12-10-7/h3-5H,2H2,1H3,(H,10,11,12)
InChI key:INHQGDXFYZBMFS-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc2c(c1)[nH]nn2
Synonyms:
  • Ethyl 1H-Benzo[D][1,2,3]Triazole-5-Carboxylate
  • Ethylbenzotriazole-5-carboxylate
  • 1H-Benzotriazole-5-carboxylic acid ethyl ester
  • ethyl 2H-benzotriazole-5-carboxylate
Found 5 products.