CymitQuimica logo

CAS 73728-40-2

:

2-(morpholin-4-ylcarbonyl)benzoate

Description:
2-(Morpholin-4-ylcarbonyl)benzoate, identified by its CAS number 73728-40-2, is an organic compound characterized by the presence of a benzoate moiety and a morpholine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The morpholine group contributes to its potential as a pharmacophore, often enhancing biological activity due to its ability to engage in hydrogen bonding and interact with biological targets. The benzoate portion of the molecule provides aromatic stability and can influence the compound's lipophilicity and overall reactivity. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can facilitate interactions with various biological systems. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including esterification and possibly coupling reactions. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C12H12NO4
InChI:InChI=1/C12H13NO4/c14-11(13-5-7-17-8-6-13)9-3-1-2-4-10(9)12(15)16/h1-4H,5-8H2,(H,15,16)/p-1
InChI key:QXNQMHHGQWNYFY-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C(=O)N1CCOCC1)C(=O)[O-]
Found 3 products.