CymitQuimica logo

CAS 737751-95-0

:

D-3-Amino-3-(2-bromophenyl)-propionic acid

Description:
D-3-Amino-3-(2-bromophenyl)-propionic acid is an amino acid derivative characterized by its unique structure, which includes a bromophenyl group attached to the propionic acid backbone. This compound features a chiral center at the alpha carbon, contributing to its designation as a D-amino acid. It is typically a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the amino and carboxylic acid functional groups. The bromine atom in the phenyl ring enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical research. This compound can be utilized in various applications, including as a building block in peptide synthesis or as a potential therapeutic agent. Its specific properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. As with many amino acid derivatives, it is important to handle this compound with care, following appropriate safety protocols.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c10-7-4-2-1-3-6(7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1
InChI key:OETRFEPZCAGEMK-MRVPVSSYSA-N
SMILES:C1=CC=C(C(=C1)[C@@H](CC(=O)O)N)Br
Synonyms:
  • (R)-3-Amino-3-(2-bromophenyl)-propionic acid
  • (R)-3-Amino-3-(2-bromo-phenyl)-propionic acid
Found 4 products.