CAS 73789-56-7

1-methylidyne-2-(triphenyl-lambda~5~-phosphanylidene)diazanium

Description:

1-Methylidyne-2-(triphenyl-lambda^5-phosphanylidene)diazanium, with the CAS number 73789-56-7, is a complex organic compound featuring a diazanium cation and a phosphanylidene group. This substance is characterized by its unique structural components, which include a diazene framework that contributes to its reactivity and stability. The presence of the triphenylphosphanylidene moiety enhances its electronic properties, making it a subject of interest in coordination chemistry and organic synthesis. The compound typically exhibits a positive charge due to the diazanium group, which can influence its solubility and interaction with other chemical species. Its reactivity may be explored in various chemical reactions, including nucleophilic attacks and coordination with transition metals. Additionally, the presence of bulky triphenyl groups can affect steric hindrance and influence the compound's overall stability and reactivity profile. Overall, this compound represents a fascinating area of study within the field of organophosphorus chemistry and may have potential applications in materials science and catalysis.

Formula: C₁₉H₁₆N₂P

InChI: InChI=1/C19H16N2P/c1-20-21-22(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h1-16H/q+1

SMILES: [CH]=NN=P(c1ccccc1)(c1ccccc1)c1ccccc1

Synonyms:

• (Isocyanoimino)triphenylphosphorane

(Isocyanoimino)triphenylphosphorane

CAS: 73789-56-7

Formula: C₁₉H₁₅N₂P

Purity: >95.0%(HPLC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 302.32

Ref: 3B-I0643

(ISOCYANOIMINO)TRIPHENYLPHOSPHORANE

CAS: 73789-56-7

Formula: C₁₉H₁₅N₂P

Purity: 95%

Color and Shape: Solid

Molecular weight: 302.3096

Ref: IN-DA003C1H

(N-Isocyanoimino)Triphenylphosphorane

CAS: 73789-56-7

(N-Isocyanoimino)Triphenylphosphorane

Purity: 95%

Molecular weight: 303.32g/mol

Ref: 54-OR1008382

(Isocyanoimino)triphenylphosphorane

CAS: 73789-56-7

(Isocyanoimino)triphenylphosphorane is a versatile compound commonly used in research laboratories. It serves as an electrode material and is often employed in electrochemical experiments. This compound has acidic properties and can react with aluminum, cyanide, and other substances to form various derivatives. Researchers have also studied its potential role in serotonin toxicity and its ability to interact with hydroxyl groups, dopamine, hypochlorous acid, fatty acids, potassium chloride, and methanol. (Isocyanoimino)triphenylphosphorane is a valuable tool for scientists conducting experiments and investigations in the field of chemistry.

Formula: C₁₉H₁₅N₂P

Purity: Min. 95%

Molecular weight: 302.32 g/mol

Ref: 3D-YCA78956