CAS 73789-56-7
:1-methylidyne-2-(triphenyl-lambda~5~-phosphanylidene)diazanium
Description:
1-Methylidyne-2-(triphenyl-lambda^5-phosphanylidene)diazanium, with the CAS number 73789-56-7, is a complex organic compound featuring a diazanium cation and a phosphanylidene group. This substance is characterized by its unique structural components, which include a diazene framework that contributes to its reactivity and stability. The presence of the triphenylphosphanylidene moiety enhances its electronic properties, making it a subject of interest in coordination chemistry and organic synthesis. The compound typically exhibits a positive charge due to the diazanium group, which can influence its solubility and interaction with other chemical species. Its reactivity may be explored in various chemical reactions, including nucleophilic attacks and coordination with transition metals. Additionally, the presence of bulky triphenyl groups can affect steric hindrance and influence the compound's overall stability and reactivity profile. Overall, this compound represents a fascinating area of study within the field of organophosphorus chemistry and may have potential applications in materials science and catalysis.
Formula:C19H16N2P
InChI:InChI=1/C19H16N2P/c1-20-21-22(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h1-16H/q+1
SMILES:[CH]=NN=P(c1ccccc1)(c1ccccc1)c1ccccc1
Synonyms:- (Isocyanoimino)triphenylphosphorane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Isocyanoimino)triphenylphosphorane
CAS:Formula:C19H15N2PPurity:>95.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:302.32(N-Isocyanoimino)Triphenylphosphorane
CAS:(N-Isocyanoimino)TriphenylphosphoraneFormula:C19H16N2PPurity:95%Molecular weight:303.32(ISOCYANOIMINO)TRIPHENYLPHOSPHORANE
CAS:Formula:C19H15N2PPurity:95%Color and Shape:SolidMolecular weight:302.3096(Isocyanoimino)triphenylphosphorane
CAS:(Isocyanoimino)triphenylphosphorane is a versatile compound commonly used in research laboratories. It serves as an electrode material and is often employed in electrochemical experiments. This compound has acidic properties and can react with aluminum, cyanide, and other substances to form various derivatives. Researchers have also studied its potential role in serotonin toxicity and its ability to interact with hydroxyl groups, dopamine, hypochlorous acid, fatty acids, potassium chloride, and methanol. (Isocyanoimino)triphenylphosphorane is a valuable tool for scientists conducting experiments and investigations in the field of chemistry.
Formula:C19H15N2PPurity:Min. 95%Molecular weight:302.32 g/mol



