CymitQuimica logo

CAS 73789-86-3

:

1-(bromomethyl)-4-(propan-2-yl)benzene

Description:
1-(Bromomethyl)-4-(propan-2-yl)benzene, also known by its CAS number 73789-86-3, is an organic compound characterized by the presence of a bromomethyl group and an isopropyl substituent on a benzene ring. This compound features a bromine atom attached to a carbon chain that is further connected to a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The isopropyl group enhances the hydrophobic character of the molecule, influencing its solubility and interaction with other substances. Typically, compounds like this can participate in nucleophilic substitution reactions due to the presence of the bromine atom, making them useful intermediates in the synthesis of more complex organic molecules. Additionally, the compound may exhibit moderate volatility and can be handled with standard laboratory precautions. Its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and structural characteristics, which are essential for determining its behavior in various chemical environments.
Formula:C10H13Br
InChI:InChI=1/C10H13Br/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,7H2,1-2H3
InChI key:YXTHBZLABLYGEE-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(cc1)CBr
Synonyms:
  • 1-(Bromomethyl)-4-isopropylbenzene
  • Benzene, 1-(Bromomethyl)-4-(1-Methylethyl)-
Found 5 products.