CymitQuimica logo

CAS 7400-96-6

:

3-amino-4-methoxy-N,N-dimethylbenzenesulfonamide

Description:
3-Amino-4-methoxy-N,N-dimethylbenzenesulfonamide, with the CAS number 7400-96-6, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzene ring substituted with an amino group and a methoxy group, along with two methyl groups attached to the nitrogen atom of the sulfonamide. The presence of the amino group contributes to its potential as a building block in pharmaceuticals, while the methoxy group can influence its solubility and reactivity. The sulfonamide moiety is significant in medicinal chemistry, often associated with various therapeutic applications, including antimicrobial agents. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide and amino groups. Its chemical behavior can be influenced by pH, as sulfonamides can exist in different ionic forms depending on the acidity of the environment. Overall, this compound's unique structure makes it a subject of interest in both synthetic and medicinal chemistry.
Formula:C9H14N2O3S
InChI:InChI=1/C9H14N2O3S/c1-11(2)15(12,13)7-4-5-9(14-3)8(10)6-7/h4-6H,10H2,1-3H3
InChI key:LEDOHLBFUWTDPD-UHFFFAOYSA-N
SMILES:CN(C)S(=O)(=O)c1ccc(c(c1)N)OC
Synonyms:
  • 3-Amino-4-methoxy-N,N-dimethyl-benzenesulfonamide
  • benzenesulfonamide, 3-amino-4-methoxy-N,N-dimethyl-
Found 2 products.