CymitQuimica logo

CAS 7409-09-8

:

4-(Ethylamino)benzoic acid

Description:
4-(Ethylamino)benzoic acid, also known as para-ethylaminobenzoic acid, is an aromatic carboxylic acid characterized by the presence of an ethylamino group attached to the para position of a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid functional group. It exhibits properties typical of both amines and carboxylic acids, including the ability to form salts and participate in acid-base reactions. The ethylamino group contributes to its basicity, while the carboxylic acid group provides acidic characteristics. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and dyes. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-2-10-8-5-3-7(4-6-8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12)
InChI key:SWXFMMWYVSYQGF-UHFFFAOYSA-N
SMILES:CCNc1ccc(cc1)C(=O)O
Found 3 products.