CymitQuimica logo

CAS 741293-42-5

:

9H-Carbazole, 3,6-dibromo-9-[4-(1,1-dimethylethyl)phenyl]-

Description:
9H-Carbazole, 3,6-dibromo-9-[4-(1,1-dimethylethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a carbazole core substituted with bromine and a tert-butylphenyl group. The presence of bromine atoms at the 3 and 6 positions of the carbazole ring enhances its reactivity and may influence its electronic properties, making it potentially useful in various applications, including organic electronics and materials science. The tert-butyl group contributes to the compound's hydrophobicity and steric bulk, which can affect its solubility and interaction with other molecules. This compound is likely to exhibit interesting photophysical properties due to the conjugated system of the carbazole moiety, making it a candidate for use in light-emitting devices or as a fluorescent probe. Additionally, the presence of multiple functional groups suggests potential for further chemical modification, allowing for the exploration of its reactivity and utility in synthetic chemistry. Overall, this compound exemplifies the diverse chemistry of substituted carbazoles.
Formula:C22H19Br2N
InChI:InChI=1S/C22H19Br2N/c1-22(2,3)14-4-8-17(9-5-14)25-20-10-6-15(23)12-18(20)19-13-16(24)7-11-21(19)25/h4-13H,1-3H3
InChI key:JIWBCHGVZITSFJ-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br
Found 4 products.