CymitQuimica logo

CAS 741709-58-0

:

1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]ethanone

Description:
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]ethanone, with the CAS number 741709-58-0, is a chemical compound characterized by its unique structure that includes a pyridine ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both organic and organoboron chemistry, making it of interest in various applications, including medicinal chemistry and materials science. The presence of the dioxaborolane group suggests potential reactivity in cross-coupling reactions, which are valuable in synthetic organic chemistry. Additionally, the pyridine ring contributes to the compound's electronic properties and may influence its solubility and stability. The compound is likely to be a solid at room temperature, with potential applications in drug development or as a building block in organic synthesis. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular architecture, making it a subject of interest for further research in chemical synthesis and application.
Formula:C13H18BNO3
InChI:InChI=1/C13H18BNO3/c1-9(16)11-8-10(6-7-15-11)14-17-12(2,3)13(4,5)18-14/h6-8H,1-5H3
InChI key:DYRIBTLLHRHBGE-UHFFFAOYSA-N
SMILES:CC(=O)c1cc(ccn1)B1OC(C)(C)C(C)(C)O1
Found 4 products.