CymitQuimica logo

CAS 74228-83-4

:

Phenyl-2,3,4,5,6-d5-alanine-b,b-d2 (9CI)

Description:
Phenyl-2,3,4,5,6-d5-alanine-b,b-d2 (9CI) is a deuterated derivative of the amino acid phenylalanine, characterized by the incorporation of deuterium isotopes at specific positions in its molecular structure. This compound is primarily used in research applications, particularly in studies involving isotopic labeling, which can help trace metabolic pathways or investigate protein structures through techniques like NMR spectroscopy. The presence of deuterium enhances the stability and solubility of the compound while providing unique spectral properties that facilitate analysis. As an amino acid, it retains the fundamental characteristics of phenylalanine, including its role as a building block for proteins and its involvement in various biochemical processes. The specific isotopic labeling allows for precise tracking in complex biological systems, making it valuable in both biochemical and pharmaceutical research. Overall, this compound exemplifies the utility of isotopically labeled substances in advancing our understanding of molecular interactions and metabolic processes.
Formula:C9H4D7NO2
InChI:InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i1D,2D,3D,4D,5D,6D2
InChI key:COLNVLDHVKWLRT-XZJKGWKKSA-N
SMILES:[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C(C(=O)O)N)[2H])[2H]
Synonyms:
  • DL-Phenyl-2,3,4,5,6-d5-alanine-b,b-d2
Found 3 products.