CymitQuimica logo

CAS 74290-65-6

:

3-bromo-5-methyl-pyrazin-2-amine

Description:
3-Bromo-5-methyl-pyrazin-2-amine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 3-position and a methyl group at the 5-position of the pyrazine ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. It may also display interesting reactivity patterns, such as electrophilic substitution or nucleophilic reactions, owing to the electron-withdrawing effects of the bromine atom. The amine group can participate in various chemical transformations, making it a potential candidate for applications in pharmaceuticals or agrochemicals. Additionally, the compound's structure suggests potential biological activity, although specific biological properties would require further investigation. Overall, 3-bromo-5-methyl-pyrazin-2-amine is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C5H6BrN3
InChI:InChI=1/C5H6BrN3/c1-3-2-8-5(7)4(6)9-3/h2H,1H3,(H2,7,8)
InChI key:VQNGEHYFPRPIGF-UHFFFAOYSA-N
SMILES:Cc1cnc(c(Br)n1)N
Synonyms:
  • 2-Pyrazinamine, 3-Bromo-5-Methyl-
  • 3-Bromo-5-methylpyrazin-2-amine
Found 4 products.