CAS 74409-52-2
:Chloropropyltheobromine
Description:
Chloropropyltheobromine, with the CAS number 74409-52-2, is a chemical compound that belongs to the class of theobromine derivatives. It is characterized by the presence of a chloropropyl group attached to the theobromine structure, which is a methylxanthine alkaloid found in cocoa and tea. This modification can influence its pharmacological properties, potentially enhancing its bioactivity or altering its solubility. Chloropropyltheobromine may exhibit stimulant effects similar to those of theobromine, which is known for its mild diuretic and vasodilatory properties. The compound is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential applications in developing therapeutic agents. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its interactions with biological systems. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H13ClN4O2
InChI:InChI=1/C10H13ClN4O2/c1-13-6-12-8-7(13)9(16)15(5-3-4-11)10(17)14(8)2/h6H,3-5H2,1-2H3
SMILES:Cn1cnc2c1c(=O)n(CCCCl)c(=O)n2C
Synonyms:- 1-(3-Chloropropyl)theobromine
- 1-(3-chloropropyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(3-Chloropropyl)theobromine
CAS:Formula:C10H13ClN4O2Purity:>97.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:256.691-(3-Chloropropyl)theobromine
CAS:1-(3-Chloropropyl)theobromineFormula:C10H13ClN4O2Purity:>97.0%Molecular weight:256.691-(3-Chloropropyl)-3,7-dimethyl-1H-purine-2,6(3H,7H)-dione
CAS:Formula:C10H13ClN4O2Purity:98%Color and Shape:SolidMolecular weight:256.68881-(3-Chloropropyl)theobromine
CAS:Controlled ProductStability Moisture Sensitive
Applications 1-(3-Chloropropyl)theobromine (cas# 74409-52-2) is a useful research chemical.Formula:C10H13N4O2ClColor and Shape:NeatMolecular weight:256.681-(3-Chloropropyl)-3,7-dimethyl-1H-purine-2,6(3H,7H)-dione
CAS:Formula:C10H13ClN4O2Purity:98%Color and Shape:SolidMolecular weight:256.691-(3-Chloropropyl)theobromine
CAS:Controlled Product1-(3-Chloropropyl)theobromine is the reaction product of acetylacetone with carbonate and water. It is a high-yielding remedy for cerebral thrombosis and other alkali burns. The chemical formula for 1-(3-chloropropyl)theobromine is C10H14ClO2. It is soluble in water, which makes it an excellent antidote for alkali burns. Acetylacetone reacts with carbonate to produce the alkanol, which then reacts with water to form 1-(3-chloropropyl)theobromine. This chemical has been found to be an effective treatment for cerebral thrombosis and other alkali burns due to its ability to react with both water and blood clots.
Formula:C10H13ClN4O2Purity:Min. 95%Molecular weight:256.69 g/mol





