CymitQuimica logo

CAS 744171-82-2

:

Imidazo[1,2-a]pyridine-6-carboxylicacid, 5,6,7,8-tetrahydro-

Description:
Imidazo[1,2-a]pyridine-6-carboxylic acid, 5,6,7,8-tetrahydro- is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its polarity and solubility in polar solvents. The tetrahydro configuration indicates the presence of a saturated ring structure, which can influence its reactivity and biological activity. Typically, compounds of this class may exhibit pharmacological properties, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the ring systems often allows for hydrogen bonding and interactions with biological targets. Additionally, the compound's molecular structure may facilitate various synthetic modifications, enabling the development of derivatives with tailored properties. Overall, imidazo[1,2-a]pyridine derivatives are studied for their potential applications in drug discovery and development, particularly in areas such as anti-inflammatory and anti-cancer therapies.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c11-8(12)6-1-2-7-9-3-4-10(7)5-6/h3-4,6H,1-2,5H2,(H,11,12)
InChI key:IZKSCLJWFFCROV-UHFFFAOYSA-N
SMILES:C1CC2=NC=CN2CC1C(=O)O
Synonyms:
  • Imidazo[1,2-a]pyridine-6-carboxylic acid, 5,6,7,8-tetrahydro- (9CI)
  • 5H,6H,7H,8H-imidazo[1,2-a]pyridine-6-carboxylic acid hydrochloride
  • 5,6,7,8-Tetrahydro-iMidazo[1,2-a]pyridine-6-carboxylic acid hydrochloride
Found 4 products.