CymitQuimica logo

CAS 74420-15-8

:

3-Bromo-7-azaindole

Description:
3-Bromo-7-azaindole is a heterocyclic organic compound characterized by the presence of a bromine atom and a nitrogen atom within its indole structure. The compound features a bicyclic framework that includes a pyrrole ring fused to a benzene ring, with the nitrogen atom located at the 7-position of the indole system. The bromine substituent is located at the 3-position, which can influence the compound's reactivity and properties. 3-Bromo-7-azaindole is typically a solid at room temperature and is soluble in organic solvents, making it useful in various chemical reactions and applications, particularly in medicinal chemistry and material science. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of the bromine atom can facilitate further functionalization, enhancing its utility in synthetic chemistry. Overall, 3-Bromo-7-azaindole is a versatile compound with significant implications in research and development within the fields of organic and medicinal chemistry.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H,(H,9,10)
InChI key:VJDGIJDCXIEXPF-UHFFFAOYSA-N
SMILES:C1=CC2=C(NC=C2Br)N=C1
Synonyms:
  • 3-Bromo-1H-pyrrolo[2,3-b]pyridine
Found 7 products.