CymitQuimica logo

CAS 74441-06-8

:

4-Amino-N-[4-(aminocarbonyl)phenyl]benzamide

Description:
4-Amino-N-[4-(aminocarbonyl)phenyl]benzamide, with the CAS number 74441-06-8, is an organic compound characterized by its amide functional group and multiple amino groups. This compound features a benzamide structure, where a benzene ring is substituted with an amino group and a para-substituted phenyl group that contains an aminocarbonyl moiety. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure indicates that it could participate in hydrogen bonding, influencing its physical properties like melting point and solubility. Additionally, the presence of multiple amino groups may enhance its ability to interact with biological targets, potentially leading to applications in drug development or as a biochemical probe. Overall, 4-Amino-N-[4-(aminocarbonyl)phenyl]benzamide is a compound of interest in both synthetic and medicinal chemistry.
Formula:C14H13N3O2
InChI:InChI=1S/C14H13N3O2/c15-11-5-1-10(2-6-11)14(19)17-12-7-3-9(4-8-12)13(16)18/h1-8H,15H2,(H2,16,18)(H,17,19)
InChI key:InChIKey=FSPYMSUDIVFOHY-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(N)=O)C=C1)(=O)C2=CC=C(N)C=C2
Synonyms:
  • 4-Amino-N-[(4 Aminocarbonyl)-phenyl]benzamide
  • 4-Aminobenzoyl benzamide
  • 4-amino-N-(4-carbamoylphenyl)benzamide
  • Benzamide, 4-amino-N-[4-(aminocarbonyl)phenyl]-
  • Pababa
Found 3 products.