CymitQuimica logo

CAS 74457-86-6

:

2'-FLUORO-4'-METHOXYACETOPHENONE

Description:
2'-Fluoro-4'-methoxyacetophenone, with the CAS number 74457-86-6, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methoxy group attached to a phenyl ring. This compound typically exhibits a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. The methoxy group, being an electron-donating substituent, can also affect the electronic properties of the molecule, potentially altering its reactivity and interaction with other chemical species. In terms of physical properties, compounds like this often have moderate to high melting and boiling points due to their molecular weight and structure. Additionally, 2'-fluoro-4'-methoxyacetophenone may be utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to its unique chemical characteristics. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C8H5ClF3NO
InChI:InChI=1/C8H5ClF3NO/c9-7(13-14)5-3-1-2-4-6(5)8(10,11)12/h1-4,14H/b13-7+
InChI key:PIRRWUMTIBFCCW-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=C(C=C1)OC)F
Synonyms:
  • 1-(2-Fluoro-4-methoxyphenyl)ethanone
  • 2'-Fluoro-4'-methoxylacetophenone
  • N-hydroxy-2-(trifluoromethyl)benzimidoyl chloride
  • 2-Fluoro-4-methoxyacetophenone
Found 7 products.