CAS 7464-14-4
:2-Hydroxy-5-methyl-3-nitropyridine
Description:
2-Hydroxy-5-methyl-3-nitropyridine, with the CAS number 7464-14-4, is an organic compound belonging to the pyridine family. It features a pyridine ring substituted with a hydroxyl group (-OH), a methyl group (-CH3), and a nitro group (-NO2), which contribute to its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. The presence of the hydroxyl group enhances its solubility in polar solvents, while the nitro group can influence its reactivity and stability. Additionally, 2-Hydroxy-5-methyl-3-nitropyridine may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many nitro compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C6H6N2O3
InChI:InChI=1/C6H6N2O3/c1-4-2-5(8(10)11)6(9)7-3-4/h2-3H,1H3,(H,7,9)
SMILES:Cc1cc(c(nc1)O)N(=O)=O
Synonyms:- 2-Hydroxy-3-nitro-5-methylpyridine
- 5-methyl-3-nitropyridin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Hydroxy-5-methyl-3-nitropyridine
CAS:Formula:C6H6N2O3Purity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:154.132-Hydroxy-5-methyl-3-nitropyridine
CAS:2-Hydroxy-5-methyl-3-nitropyridineFormula:C6H6N2O3Purity:98%Color and Shape:Pale yellow Solid-PowderMolecular weight:154.123445-Methyl-3-nitro-2(1H)-pyridinone
CAS:Formula:C6H6N2O3Purity:98%Color and Shape:SolidMolecular weight:154.12342-Hydroxy-5-methyl-3-nitropyridine
CAS:Formula:C6H6N2O3Purity:98%Color and Shape:SolidMolecular weight:154.1252-Hydroxy-5-methyl-3-nitropyridine
CAS:2-Hydroxy-5-methyl-3-nitropyridine (HMPN) is a synthetic compound that is used as a reagent for the synthesis of other compounds. It has been shown to be reactive with molybdenum and chloride, boosting the reaction yield and reaction time. The functional theory of HMPN has been used to explain its reactivity with xylene. 2-Hydroxy-5-methyl-3-nitropyridine can be described as a compound that is capable of undergoing dehydration reactions, which are characterized by the removal of water molecules from the molecule to form a new product. This process can be achieved through the addition of phenylacetonitrile or azobenzene to HMPN.
Formula:C6H6N2O3Purity:Min. 95%Molecular weight:154.12 g/mol





