CymitQuimica logo

CAS 748812-61-5

:

tert-butyl N-(5-bromo-3-methyl-2-pyridyl)carbamate

Description:
Tert-butyl N-(5-bromo-3-methyl-2-pyridyl)carbamate is a chemical compound characterized by its structure, which includes a tert-butyl group, a carbamate functional group, and a pyridine ring substituted with a bromine atom and a methyl group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. The tert-butyl group contributes to the compound's lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the pyridine ring is known for its role in various chemical reactions and as a building block in pharmaceuticals. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, tert-butyl N-(5-bromo-3-methyl-2-pyridyl)carbamate is a versatile compound with applications in research and development within the field of chemistry.
Formula:C11H15BrN2O2
InChI:InChI=1/C11H15BrN2O2/c1-7-5-8(12)6-13-9(7)14-10(15)16-11(2,3)4/h5-6H,1-4H3,(H,13,14,15)
InChI key:PMFVIRYXHAMNRY-UHFFFAOYSA-N
SMILES:Cc1cc(cnc1N=C(O)OC(C)(C)C)Br
Synonyms:
  • tert-Butyl (5-bromo-3-methylpyridin-2-yl)carbamate
Found 4 products.