CAS 74916-57-7

Butanedioic acid, 2-mercapto-, gold(1+) sodium salt (1:1:2)

Description:

Butanedioic acid, 2-mercapto-, gold(1+) sodium salt (1:1:2), commonly referred to as a gold thiolate, is a coordination compound that features a butanedioic acid backbone with a mercapto group, which enhances its reactivity and solubility in various solvents. This compound typically exhibits properties associated with both organic acids and metal complexes, including potential chelation with gold ions, which can influence its stability and reactivity. The presence of the sodium salt form indicates that it is likely soluble in water, making it useful in various applications, including catalysis and materials science. The thiol group (-SH) contributes to its ability to form strong bonds with metals, while the butanedioic acid moiety may provide additional functional properties. Overall, this compound is of interest in fields such as nanotechnology and biochemistry, where metal-thiol interactions play a crucial role in the development of novel materials and therapeutic agents.

Formula: C₄H₆O₄S·Au·2Na

InChI: InChI=1S/C4H6O4S.Au.2Na/c5-3(6)1-2(9)4(7)8;;;/h2,9H,1H2,(H,5,6)(H,7,8);;;

InChI key: InChIKey=OURKECAJQJFKIV-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(C(O)=O)S.[Au].[Na]

Synonyms:

• NSC 3211
• Butanedioic acid, mercapto-, gold(1+) disodium salt
• Butanedioic acid, 2-mercapto-, gold(1+) sodium salt (1:1:2)

Aurothiomalate sodium

CAS: 74916-57-7

Sodium aurothiomalate (Miochrysin) inhibits PKC-ι, TrxR; used as an anti-rheumatic and has anti-tumor properties.

Formula: C₄H₃AuNa₂O₄S

Purity: 99.19%

Color and Shape: Solid

Molecular weight: 390.07

Ref: TM-T20168