CAS 74920-80-2
:MDEPAP (=1-Methyl-4-(4-diethylaminophenylazo)pyridinium iodide)
Description:
MDEPAP, or 1-Methyl-4-(4-diethylaminophenylazo)pyridinium iodide, is a synthetic organic compound characterized by its azo dye structure, which features a pyridinium moiety and a diethylaminophenyl group. This compound typically exhibits vibrant coloration due to the presence of the azo functional group, which is known for its ability to absorb visible light, making it useful in various applications such as dyes and pigments. MDEPAP is soluble in polar solvents, which enhances its utility in different chemical environments. The presence of the quaternary ammonium structure contributes to its ionic nature, influencing its solubility and reactivity. Additionally, MDEPAP may exhibit photostability and thermal stability, making it suitable for applications in textiles and inks. However, like many azo compounds, it is essential to consider potential environmental and health impacts, as some azo dyes can be toxic or carcinogenic upon degradation. Proper handling and disposal practices are recommended to mitigate any risks associated with its use.
Formula:C16H21IN4
InChI:InChI=1/C16H21N4.HI/c1-4-20(5-2)16-8-6-14(7-9-16)17-18-15-10-12-19(3)13-11-15;/h6-13H,4-5H2,1-3H3;1H/q+1;/p-1
Synonyms:- 4-{(E)-[4-(diethylamino)phenyl]diazenyl}-1-methylpyridinium iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
MDEPAP [=1-Methyl-4-(4-diethylaminophenylazo)pyridinium Iodide] [Extraction-spectrophotometric reagent for anionic surfactants]
CAS:Formula:C16H21IN4Purity:>95.0%(HPLC)(N)Color and Shape:Light gray to Brown to Black powder to crystalMolecular weight:396.28MDEPAP [=1-Methyl-4-(4-diethylaminophenylazo)pyridinium Iodide] [Extraction-spectrophotometric reagent for anionic surfactants]
CAS:MDEPAP [=1-Methyl-4-(4-diethylaminophenylazo)pyridinium Iodide] [Extraction-spectrophotometric reagent for anionic surfactants]Formula:C16H21IN4Purity:>95.0%Molecular weight:396.28



