CAS 749234-11-5

4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine

Description:

4,5,6,7-Tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with four bromine atoms and two dimethylamino groups. This compound typically exhibits high stability due to the presence of multiple bromine atoms, which can enhance its reactivity in certain chemical reactions. The bromine substituents may impart significant hydrophobic characteristics, influencing its solubility in various solvents. Additionally, the dimethylamino groups can contribute to the compound's basicity and potential interactions with biological systems. The presence of the benzimidazole moiety suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development, given its biological activity in various contexts. However, the toxicity and environmental impact of brominated compounds should be considered, as they can pose risks to health and ecosystems. Overall, this compound's unique structural features make it a subject of interest in both synthetic chemistry and medicinal research.

Formula: C₉H₇Br₄N₃

InChI: InChI=1/C9H7Br4N3/c1-16(2)9-14-7-5(12)3(10)4(11)6(13)8(7)15-9/h1-2H3,(H,14,15)

SMILES: CN(C)c1nc2c(c(c(c(c2[nH]1)Br)Br)Br)Br

Synonyms:

• 1H-Benzimidazol-2-amine, 4,5,6,7-tetrabromo-N,N-dimethyl-
• 2-dimethylamino-4,5,6,7-tetrabromo-1H-benzimidazole

DMAT

CAS: 749234-11-5

Formula: C₉H₇Br₄N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 476.7880

Ref: IN-DA003P0I

DMAT

CAS: 749234-11-5

DMAT

Purity: ≥98%

Molecular weight: 476.79g/mol

Ref: 54-BUP06545

DMAT

CAS: 749234-11-5

Ref: 7W-GW4248

DMAT

CAS: 749234-11-5

DMAT (Casein kinase II Inhibitor) is a potent and specific inhibitor of CK2(IC50 value of 130 nM).

Formula: C₉H₇Br₄N₃

Purity: 99.48%

Color and Shape: Solid

Molecular weight: 476.79

Ref: TM-T7390

DMAT

CAS: 749234-11-5

Inhibitor of protein kinase CK2

Formula: C₉H₇Br₄N₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 476.79 g/mol

Ref: 3D-FD65008

4,5,6,7-TETRABROMO-N,N-DIMETHYL-1H-BENZO[D]IMIDAZOL-2-AMINE

CAS: 749234-11-5

Purity: 98%

Molecular weight: 476.7919922

Ref: 10-F808344